C20H26FN3O3 — CID 122567428
1-[(4-fluorophenyl)methyl]-3-[1-(furan-2-ylmethyl)piperidin-4-yl]-1-(2-hydroxyethyl)urea (PubChem CID 122567428) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[1-(furan-2-ylmethyl)piperidin-4-yl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[1-(furan-2-ylmethyl)piperidin-4-yl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 122567428 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[1-(furan-2-ylmethyl)piperidin-4-yl]-1-(2-hydroxyethyl)urea |
| SMILES | O=C(NC1CCN(Cc2ccco2)CC1)N(CCO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O3/c21-17-5-3-16(4-6-17)14-24(11-12-25)20(26)22-18-7-9-23(10-8-18)15-19-2-1-13-27-19/h1-6,13,18,25H,7-12,14-15H2,(H,22,26) |
| InChIKey | TVLPYFMBAZGDBZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |