C13H24N6O — CID 122568157
N-[[1-(dimethylamino)cyclopentyl]methyl]-4-(tetrazol-1-yl)butanamide (PubChem CID 122568157) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclopentyl]methyl]-4-(tetrazol-1-yl)butanamide.
| Compound Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 122568157 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-4-(tetrazol-1-yl)butanamide |
| SMILES | CN(C)C1(CNC(=O)CCCn2cnnn2)CCCC1 |
| InChI | InChI=1S/C13H24N6O/c1-18(2)13(7-3-4-8-13)10-14-12(20)6-5-9-19-11-15-16-17-19/h11H,3-10H2,1-2H3,(H,14,20) |
| InChIKey | BCUNNLHRDQEFOY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |