C15H18N4O2 — CID 122569461
1-[3-[(3-phenyl-1,2,4-oxadiazol-5-yl)amino]piperidin-1-yl]ethanone (PubChem CID 122569461) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[3-[(3-phenyl-1,2,4-oxadiazol-5-yl)amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[(3-phenyl-1,2,4-oxadiazol-5-yl)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 122569461 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[3-[(3-phenyl-1,2,4-oxadiazol-5-yl)amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(Nc2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C15H18N4O2/c1-11(20)19-9-5-8-13(10-19)16-15-17-14(18-21-15)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-10H2,1H3,(H,16,17,18) |
| InChIKey | GTZAHBPPWBYKPW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |