C14H20N4O2 — CID 122569856
(1R,6R)-6-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]cyclohex-3-ene-1-carboxamide (PubChem CID 122569856) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (1R,6R)-6-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 122569856 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (1R,6R)-6-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1cc(C)n(CC(=O)N[C@@H]2CC=CC[C@H]2C(N)=O)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-9-7-10(2)18(17-9)8-13(19)16-12-6-4-3-5-11(12)14(15)20/h3-4,7,11-12H,5-6,8H2,1-2H3,(H2,15,20)(H,16,19)/t11-,12-/m1/s1 |
| InChIKey | KOBZRRXVXHSWDJ-VXGBXAGGSA-N |
| XLogP | 0.44 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|