C15H22N4O — CID 122558492
(1R,6R)-6-[(6-methyl-2-propylpyrimidin-4-yl)amino]cyclohex-3-ene-1-carboxamide (PubChem CID 122558492) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (1R,6R)-6-[(6-methyl-2-propylpyrimidin-4-yl)amino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-[(6-methyl-2-propylpyrimidin-4-yl)amino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 122558492 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (1R,6R)-6-[(6-methyl-2-propylpyrimidin-4-yl)amino]cyclohex-3-ene-1-carboxamide |
| SMILES | CCCc1nc(C)cc(N[C@@H]2CC=CC[C@H]2C(N)=O)n1 |
| InChI | InChI=1S/C15H22N4O/c1-3-6-13-17-10(2)9-14(19-13)18-12-8-5-4-7-11(12)15(16)20/h4-5,9,11-12H,3,6-8H2,1-2H3,(H2,16,20)(H,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | HPZARWOEPGKUFW-VXGBXAGGSA-N |
| XLogP | 1.97 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|