C15H17N3O2 — CID 122563304
(1R,6R)-6-[(5-methyl-1,3-benzoxazol-2-yl)amino]cyclohex-3-ene-1-carboxamide (PubChem CID 122563304) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1R,6R)-6-[(5-methyl-1,3-benzoxazol-2-yl)amino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-[(5-methyl-1,3-benzoxazol-2-yl)amino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 122563304 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (1R,6R)-6-[(5-methyl-1,3-benzoxazol-2-yl)amino]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc2oc(N[C@@H]3CC=CC[C@H]3C(N)=O)nc2c1 |
| InChI | InChI=1S/C15H17N3O2/c1-9-6-7-13-12(8-9)18-15(20-13)17-11-5-3-2-4-10(11)14(16)19/h2-3,6-8,10-11H,4-5H2,1H3,(H2,16,19)(H,17,18)/t10-,11-/m1/s1 |
| InChIKey | JODNQMHVXWJMDF-GHMZBOCLSA-N |
| XLogP | 2.37 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|