C17H18N4O2 — CID 118289402
1,1-dimethyl-3-[4-[(5-methyl-1,3-benzoxazol-2-yl)amino]phenyl]urea (PubChem CID 118289402) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-[(5-methyl-1,3-benzoxazol-2-yl)amino]phenyl]urea.
| Compound Name | 1,1-dimethyl-3-[4-[(5-methyl-1,3-benzoxazol-2-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 118289402 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1,1-dimethyl-3-[4-[(5-methyl-1,3-benzoxazol-2-yl)amino]phenyl]urea |
| SMILES | Cc1ccc2oc(Nc3ccc(NC(=O)N(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C17H18N4O2/c1-11-4-9-15-14(10-11)20-16(23-15)18-12-5-7-13(8-6-12)19-17(22)21(2)3/h4-10H,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | XBYXZZSTUAYCAC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |