C14H16N4O3 — CID 126836087
1-(5-methyl-1,3-benzoxazol-2-yl)pyrrolidine-3,4-dicarboxamide (PubChem CID 126836087) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-(5-methyl-1,3-benzoxazol-2-yl)pyrrolidine-3,4-dicarboxamide.
| Compound Name | 1-(5-methyl-1,3-benzoxazol-2-yl)pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 126836087 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-(5-methyl-1,3-benzoxazol-2-yl)pyrrolidine-3,4-dicarboxamide |
| SMILES | Cc1ccc2oc(N3CC(C(N)=O)C(C(N)=O)C3)nc2c1 |
| InChI | InChI=1S/C14H16N4O3/c1-7-2-3-11-10(4-7)17-14(21-11)18-5-8(12(15)19)9(6-18)13(16)20/h2-4,8-9H,5-6H2,1H3,(H2,15,19)(H2,16,20) |
| InChIKey | GABOLNDOYLUEDC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |