C15H18N4O3 — CID 135148582
2-(3-morpholin-4-ylazetidin-1-yl)-1,3-benzoxazole-5-carboxamide (PubChem CID 135148582) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylazetidin-1-yl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-(3-morpholin-4-ylazetidin-1-yl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 135148582 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(3-morpholin-4-ylazetidin-1-yl)-1,3-benzoxazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2oc(N3CC(N4CCOCC4)C3)nc2c1 |
| InChI | InChI=1S/C15H18N4O3/c16-14(20)10-1-2-13-12(7-10)17-15(22-13)19-8-11(9-19)18-3-5-21-6-4-18/h1-2,7,11H,3-6,8-9H2,(H2,16,20) |
| InChIKey | QXMDMYBHIXRUGT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |