About propan-2-yl formate
propan-2-yl formate (PubChem CID 12257) has the molecular formula C4H8O2
and a molecular weight of 88.11 g/mol. Its IUPAC name is propan-2-yl formate.
Molecular Properties
| Compound Name | propan-2-yl formate |
| PubChem CID | 12257 |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.05 |
| IUPAC Name | propan-2-yl formate |
| SMILES | CC(C)OC=O |
| InChI | InChI=1S/C4H8O2/c1-4(2)6-3-5/h3-4H,1-2H3 |
| InChIKey | RMOUBSOVHSONPZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl formate?
The IUPAC name of propan-2-yl formate (CID 12257) is propan-2-yl formate.
What is the SMILES notation for propan-2-yl formate?
The canonical SMILES for propan-2-yl formate is CC(C)OC=O.
What is the InChIKey of propan-2-yl formate?
The InChIKey is RMOUBSOVHSONPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2/c1-4(2)6-3-5/h3-4H,1-2H3.
What are the key properties of propan-2-yl formate?
propan-2-yl formate has a molecular weight of 88.11 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl formate is sourced from PubChem (CID 12257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).