C17H18N4O — CID 122570692
N-[2-(4-phenylpyrimidin-2-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 122570692) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[2-(4-phenylpyrimidin-2-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(4-phenylpyrimidin-2-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 122570692 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[2-(4-phenylpyrimidin-2-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1nccc(-c2ccccc2)n1)C1C=CCN1 |
| InChI | InChI=1S/C17H18N4O/c22-17(15-7-4-10-18-15)20-12-9-16-19-11-8-14(21-16)13-5-2-1-3-6-13/h1-8,11,15,18H,9-10,12H2,(H,20,22) |
| InChIKey | IDZHJSXQTJIJHZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|