C15H18F3N3O4S — CID 122575249
3-ethyl-N-methoxy-N,5-dimethyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 122575249) has the molecular formula C15H18F3N3O4S and a molecular weight of 393.39 g/mol. Its IUPAC name is 3-ethyl-N-methoxy-N,5-dimethyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-ethyl-N-methoxy-N,5-dimethyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 122575249 |
| Molecular Formula | C15H18F3N3O4S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-ethyl-N-methoxy-N,5-dimethyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCn1c(=O)c2c(C)c(C(=O)N(C)OC)sc2n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C15H18F3N3O4S/c1-5-20-11(22)9-8(2)10(12(23)19(3)25-4)26-13(9)21(14(20)24)7-6-15(16,17)18/h5-7H2,1-4H3 |
| InChIKey | GMHUNSSQEWBZGO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|