C19H22F6N2O5S — CID 118016399
tert-butyl 5-methyl-2,4-dioxo-3-(3,3,3-trifluoro-2-methoxypropyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 118016399) has the molecular formula C19H22F6N2O5S and a molecular weight of 504.45 g/mol. Its IUPAC name is tert-butyl 5-methyl-2,4-dioxo-3-(3,3,3-trifluoro-2-methoxypropyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 5-methyl-2,4-dioxo-3-(3,3,3-trifluoro-2-methoxypropyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 118016399 |
| Molecular Formula | C19H22F6N2O5S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | tert-butyl 5-methyl-2,4-dioxo-3-(3,3,3-trifluoro-2-methoxypropyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COC(Cn1c(=O)c2c(C)c(C(=O)OC(C)(C)C)sc2n(CCC(F)(F)F)c1=O)C(F)(F)F |
| InChI | InChI=1S/C19H22F6N2O5S/c1-9-11-13(28)27(8-10(31-5)19(23,24)25)16(30)26(7-6-18(20,21)22)14(11)33-12(9)15(29)32-17(2,3)4/h10H,6-8H2,1-5H3 |
| InChIKey | VKPRCUCHFJODJP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |