C17H19F3N2O5S — CID 118016294
tert-butyl 3-ethyl-5-formyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 118016294) has the molecular formula C17H19F3N2O5S and a molecular weight of 420.41 g/mol. Its IUPAC name is tert-butyl 3-ethyl-5-formyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 3-ethyl-5-formyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 118016294 |
| Molecular Formula | C17H19F3N2O5S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | tert-butyl 3-ethyl-5-formyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCn1c(=O)c2c(C=O)c(C(=O)OC(C)(C)C)sc2n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C17H19F3N2O5S/c1-5-21-12(24)10-9(8-23)11(14(25)27-16(2,3)4)28-13(10)22(15(21)26)7-6-17(18,19)20/h8H,5-7H2,1-4H3 |
| InChIKey | FAZXEVFJDBSPMX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|