C10H17NO2 — CID 122577397
1-[3-[(2S)-3-methylbutan-2-yl]-1,2-oxazol-5-yl]ethanol (PubChem CID 122577397) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[3-[(2S)-3-methylbutan-2-yl]-1,2-oxazol-5-yl]ethanol.
| Compound Name | 1-[3-[(2S)-3-methylbutan-2-yl]-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 122577397 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-[3-[(2S)-3-methylbutan-2-yl]-1,2-oxazol-5-yl]ethanol |
| SMILES | CC(O)c1cc([C@@H](C)C(C)C)no1 |
| InChI | InChI=1S/C10H17NO2/c1-6(2)7(3)9-5-10(8(4)12)13-11-9/h5-8,12H,1-4H3/t7-,8?/m0/s1 |
| InChIKey | JTJWXSYMFNDXHN-JAMMHHFISA-N |
| XLogP | 2.49 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |