C11H9Br2NO2 — CID 166596802
1-[3-(2,4-dibromophenyl)-1,2-oxazol-5-yl]ethanol (PubChem CID 166596802) has the molecular formula C11H9Br2NO2 and a molecular weight of 347.01 g/mol. Its IUPAC name is 1-[3-(2,4-dibromophenyl)-1,2-oxazol-5-yl]ethanol.
| Compound Name | 1-[3-(2,4-dibromophenyl)-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 166596802 |
| Molecular Formula | C11H9Br2NO2 |
| Molecular Weight | 347.01 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | 1-[3-(2,4-dibromophenyl)-1,2-oxazol-5-yl]ethanol |
| SMILES | CC(O)c1cc(-c2ccc(Br)cc2Br)no1 |
| InChI | InChI=1S/C11H9Br2NO2/c1-6(15)11-5-10(14-16-11)8-3-2-7(12)4-9(8)13/h2-6,15H,1H3 |
| InChIKey | GZPQNFDOINOIHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |