About 3,5-di(propan-2-yl)-1,2-oxazole;methane
3,5-di(propan-2-yl)-1,2-oxazole;methane (PubChem CID 160901645) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1,2-oxazole;methane.
Molecular Properties
| Compound Name | 3,5-di(propan-2-yl)-1,2-oxazole;methane |
| PubChem CID | 160901645 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,5-di(propan-2-yl)-1,2-oxazole;methane |
| SMILES | C.CC(C)c1cc(C(C)C)on1 |
| InChI | InChI=1S/C9H15NO.CH4/c1-6(2)8-5-9(7(3)4)11-10-8;/h5-7H,1-4H3;1H4 |
| InChIKey | SPOUSIAJYMVBKF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-di(propan-2-yl)-1,2-oxazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)-1,2-oxazole;methane?
The IUPAC name of 3,5-di(propan-2-yl)-1,2-oxazole;methane (CID 160901645) is 3,5-di(propan-2-yl)-1,2-oxazole;methane.
What is the SMILES notation for 3,5-di(propan-2-yl)-1,2-oxazole;methane?
The canonical SMILES for 3,5-di(propan-2-yl)-1,2-oxazole;methane is C.CC(C)c1cc(C(C)C)on1.
What is the InChIKey of 3,5-di(propan-2-yl)-1,2-oxazole;methane?
The InChIKey is SPOUSIAJYMVBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.CH4/c1-6(2)8-5-9(7(3)4)11-10-8;/h5-7H,1-4H3;1H4.
What are the key properties of 3,5-di(propan-2-yl)-1,2-oxazole;methane?
3,5-di(propan-2-yl)-1,2-oxazole;methane has a molecular weight of 169.27 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)-1,2-oxazole;methane is sourced from PubChem (CID 160901645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).