C10H19NO — CID 160901645
3,5-di(propan-2-yl)-1,2-oxazole;methane (PubChem CID 160901645) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1,2-oxazole;methane.
| Compound Name | 3,5-di(propan-2-yl)-1,2-oxazole;methane |
|---|---|
| PubChem CID | 160901645 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,5-di(propan-2-yl)-1,2-oxazole;methane |
| SMILES | C.CC(C)c1cc(C(C)C)on1 |
| InChI | InChI=1S/C9H15NO.CH4/c1-6(2)8-5-9(7(3)4)11-10-8;/h5-7H,1-4H3;1H4 |
| InChIKey | SPOUSIAJYMVBKF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |