C13H11ClN4S — CID 122580822
4-(11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-13-yl)-1,3-thiazole (PubChem CID 122580822) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 4-(11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-13-yl)-1,3-thiazole.
| Compound Name | 4-(11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-13-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 122580822 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-(11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-13-yl)-1,3-thiazole |
| SMILES | Clc1cc(-c2cscn2)c2c3c([nH]c2n1)CCNC3 |
| InChI | InChI=1S/C13H11ClN4S/c14-11-3-7(10-5-19-6-16-10)12-8-4-15-2-1-9(8)17-13(12)18-11/h3,5-6,15H,1-2,4H2,(H,17,18) |
| InChIKey | HYGMORQLLZJDTJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|