C19H13N3O3 — CID 122582124
2-[[4-(4-cyanophenyl)isoquinolin-6-yl]-methylamino]-2-oxoacetic acid (PubChem CID 122582124) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[[4-(4-cyanophenyl)isoquinolin-6-yl]-methylamino]-2-oxoacetic acid.
| Compound Name | 2-[[4-(4-cyanophenyl)isoquinolin-6-yl]-methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 122582124 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[[4-(4-cyanophenyl)isoquinolin-6-yl]-methylamino]-2-oxoacetic acid |
| SMILES | CN(C(=O)C(=O)O)c1ccc2cncc(-c3ccc(C#N)cc3)c2c1 |
| InChI | InChI=1S/C19H13N3O3/c1-22(18(23)19(24)25)15-7-6-14-10-21-11-17(16(14)8-15)13-4-2-12(9-20)3-5-13/h2-8,10-11H,1H3,(H,24,25) |
| InChIKey | AGICOPPGEYKZAI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|