About methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate
methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate (PubChem CID 122582517) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate |
| PubChem CID | 122582517 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate |
| SMILES | C=C(C)C1CCC(C)(C)CC1C(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C20H27NO3/c1-13(2)14-10-11-20(3,4)12-16(14)18(22)21-17-9-7-6-8-15(17)19(23)24-5/h6-9,14,16H,1,10-12H2,2-5H3,(H,21,22) |
| InChIKey | VPBAHGVGPGKYCY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate?
The IUPAC name of methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate (CID 122582517) is methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate.
What is the SMILES notation for methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate?
The canonical SMILES for methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate is C=C(C)C1CCC(C)(C)CC1C(=O)Nc1ccccc1C(=O)OC.
What is the InChIKey of methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate?
The InChIKey is VPBAHGVGPGKYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO3/c1-13(2)14-10-11-20(3,4)12-16(14)18(22)21-17-9-7-6-8-15(17)19(23)24-5/h6-9,14,16H,1,10-12H2,2-5H3,(H,21,22).
What are the key properties of methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate?
methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate has a molecular weight of 329.44 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]benzoate is sourced from PubChem (CID 122582517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).