C21H29NO3 — CID 122582512
methyl 4-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]-3-methylbenzoate (PubChem CID 122582512) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is methyl 4-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]-3-methylbenzoate.
| Compound Name | methyl 4-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 122582512 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | methyl 4-[(5,5-dimethyl-2-prop-1-en-2-ylcyclohexanecarbonyl)amino]-3-methylbenzoate |
| SMILES | C=C(C)C1CCC(C)(C)CC1C(=O)Nc1ccc(C(=O)OC)cc1C |
| InChI | InChI=1S/C21H29NO3/c1-13(2)16-9-10-21(4,5)12-17(16)19(23)22-18-8-7-15(11-14(18)3)20(24)25-6/h7-8,11,16-17H,1,9-10,12H2,2-6H3,(H,22,23) |
| InChIKey | ABDVIOODMKLKDG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|