C36H36N4O4 — CID 122584732
benzyl 2-[4-[1-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-4-yl]piperidin-1-yl]acetate (PubChem CID 122584732) has the molecular formula C36H36N4O4 and a molecular weight of 588.71 g/mol. Its IUPAC name is benzyl 2-[4-[1-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-4-yl]piperidin-1-yl]acetate.
| Compound Name | benzyl 2-[4-[1-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-4-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 122584732 |
| Molecular Formula | C36H36N4O4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | benzyl 2-[4-[1-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-4-yl]piperidin-1-yl]acetate |
| SMILES | O=C(CN1CCC(c2ccnc3c2ccn3Cc2ccc(C(=O)NOCc3ccccc3)cc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C36H36N4O4/c41-34(43-25-28-7-3-1-4-8-28)24-39-20-16-30(17-21-39)32-15-19-37-35-33(32)18-22-40(35)23-27-11-13-31(14-12-27)36(42)38-44-26-29-9-5-2-6-10-29/h1-15,18-19,22,30H,16-17,20-21,23-26H2,(H,38,42) |
| InChIKey | FZGZUMHQKJQFGF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|