C31H32N2O3 — CID 129128707
methyl 4-[[4-[4-[[4-(2-oxoethyl)phenyl]methyl]cyclohexyl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate (PubChem CID 129128707) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is methyl 4-[[4-[4-[[4-(2-oxoethyl)phenyl]methyl]cyclohexyl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[4-[[4-(2-oxoethyl)phenyl]methyl]cyclohexyl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 129128707 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 4-[[4-[4-[[4-(2-oxoethyl)phenyl]methyl]cyclohexyl]pyrrolo[2,3-b]pyridin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2ccc3c(C4CCC(Cc5ccc(CC=O)cc5)CC4)ccnc32)cc1 |
| InChI | InChI=1S/C31H32N2O3/c1-36-31(35)27-12-8-25(9-13-27)21-33-18-15-29-28(14-17-32-30(29)33)26-10-6-24(7-11-26)20-23-4-2-22(3-5-23)16-19-34/h2-5,8-9,12-15,17-19,24,26H,6-7,10-11,16,20-21H2,1H3 |
| InChIKey | HVDGAGFZFAVVOP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|