C24H30N4O2 — CID 118148391
N-butoxy-4-[(4-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzamide (PubChem CID 118148391) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-butoxy-4-[(4-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzamide.
| Compound Name | N-butoxy-4-[(4-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 118148391 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-butoxy-4-[(4-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzamide |
| SMILES | CCCCONC(=O)c1ccc(Cn2ccc3c(C4CCNCC4)ccnc32)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-2-3-16-30-27-24(29)20-6-4-18(5-7-20)17-28-15-11-22-21(10-14-26-23(22)28)19-8-12-25-13-9-19/h4-7,10-11,14-15,19,25H,2-3,8-9,12-13,16-17H2,1H3,(H,27,29) |
| InChIKey | XUIXUFPDBJGVPE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|