C12H14F3N5 — CID 122584979
8-butyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 122584979) has the molecular formula C12H14F3N5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 8-butyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 8-butyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 122584979 |
| Molecular Formula | C12H14F3N5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 8-butyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCc1cc(C(F)(F)F)nc2c(N)nc(N)nc12 |
| InChI | InChI=1S/C12H14F3N5/c1-2-3-4-6-5-7(12(13,14)15)18-9-8(6)19-11(17)20-10(9)16/h5H,2-4H2,1H3,(H4,16,17,19,20) |
| InChIKey | DAUHLDWBRRSKDU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |