C17H26N4 — CID 14478923
5-methyl-6-octylquinazoline-2,4-diamine (PubChem CID 14478923) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 5-methyl-6-octylquinazoline-2,4-diamine.
| Compound Name | 5-methyl-6-octylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 14478923 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 5-methyl-6-octylquinazoline-2,4-diamine |
| SMILES | CCCCCCCCc1ccc2nc(N)nc(N)c2c1C |
| InChI | InChI=1S/C17H26N4/c1-3-4-5-6-7-8-9-13-10-11-14-15(12(13)2)16(18)21-17(19)20-14/h10-11H,3-9H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | JPYXLPGVOXUSFJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|