About 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride
5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride (PubChem CID 44531624) has the molecular formula C13H20ClN5
and a molecular weight of 281.79 g/mol. Its IUPAC name is 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride |
| PubChem CID | 44531624 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride |
| SMILES | CCCCCc1cnc2nc(N)nc(N)c2c1C.Cl |
| InChI | InChI=1S/C13H19N5.ClH/c1-3-4-5-6-9-7-16-12-10(8(9)2)11(14)17-13(15)18-12;/h7H,3-6H2,1-2H3,(H4,14,15,16,17,18);1H |
| InChIKey | ZVWWRIKYTXNNFD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride?
The IUPAC name of 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride (CID 44531624) is 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride.
What is the SMILES notation for 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride?
The canonical SMILES for 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride is CCCCCc1cnc2nc(N)nc(N)c2c1C.Cl.
What is the InChIKey of 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride?
The InChIKey is ZVWWRIKYTXNNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5.ClH/c1-3-4-5-6-9-7-16-12-10(8(9)2)11(14)17-13(15)18-12;/h7H,3-6H2,1-2H3,(H4,14,15,16,17,18);1H.
What are the key properties of 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride?
5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride has a molecular weight of 281.79 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-pentylpyrido[2,3-d]pyrimidine-2,4-diamine;hydrochloride is sourced from PubChem (CID 44531624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).