C7H8N6 — CID 134914565
5-methylpyrimido[4,5-d]pyrimidine-2,4-diamine (PubChem CID 134914565) has the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-methylpyrimido[4,5-d]pyrimidine-2,4-diamine.
| Compound Name | 5-methylpyrimido[4,5-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134914565 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-methylpyrimido[4,5-d]pyrimidine-2,4-diamine |
| SMILES | Cc1ncnc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C7H8N6/c1-3-4-5(8)12-7(9)13-6(4)11-2-10-3/h2H,1H3,(H4,8,9,10,11,12,13) |
| InChIKey | LQFYSSBEZACUOI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |