C8H11N7 — CID 91620948
5-ethylpyrimido[4,5-d]pyrimidine-2,4,7-triamine (PubChem CID 91620948) has the molecular formula C8H11N7 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-ethylpyrimido[4,5-d]pyrimidine-2,4,7-triamine.
| Compound Name | 5-ethylpyrimido[4,5-d]pyrimidine-2,4,7-triamine |
|---|---|
| PubChem CID | 91620948 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-ethylpyrimido[4,5-d]pyrimidine-2,4,7-triamine |
| SMILES | CCc1nc(N)nc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C8H11N7/c1-2-3-4-5(9)13-8(11)15-6(4)14-7(10)12-3/h2H2,1H3,(H6,9,10,11,12,13,14,15) |
| InChIKey | LISGOJFINRTKOM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |