C6H3Cl2N3O3S — CID 122590239
(4,6-dichloro-5-cyanopyrimidin-2-yl) methanesulfonate (PubChem CID 122590239) has the molecular formula C6H3Cl2N3O3S and a molecular weight of 268.08 g/mol. Its IUPAC name is (4,6-dichloro-5-cyanopyrimidin-2-yl) methanesulfonate.
| Compound Name | (4,6-dichloro-5-cyanopyrimidin-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 122590239 |
| Molecular Formula | C6H3Cl2N3O3S |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | (4,6-dichloro-5-cyanopyrimidin-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1nc(Cl)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C6H3Cl2N3O3S/c1-15(12,13)14-6-10-4(7)3(2-9)5(8)11-6/h1H3 |
| InChIKey | SVDSYJRVIQXWBJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|