C29H43N7O6 — CID 122591533
2-[[2-[[1-[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid (PubChem CID 122591533) has the molecular formula C29H43N7O6 and a molecular weight of 585.71 g/mol. Its IUPAC name is 2-[[2-[[1-[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[1-[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 122591533 |
| Molecular Formula | C29H43N7O6 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 2-[[2-[[1-[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C29H43N7O6/c1-17(2)25(28(41)33-16-24(37)38)35-27(40)23-11-7-13-36(23)29(42)22(10-5-6-12-30)34-26(39)20(31)14-18-15-32-21-9-4-3-8-19(18)21/h3-4,8-9,15,17,20,22-23,25,32H,5-7,10-14,16,30-31H2,1-2H3,(H,33,41)(H,34,39)(H,35,40)(H,37,38) |
| InChIKey | MNKUYPCGVICRSR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 212.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|