C27H40N6O5 — CID 18310137
2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18310137) has the molecular formula C27H40N6O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18310137 |
| Molecular Formula | C27H40N6O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H40N6O5/c1-16(2)23(32-24(34)19(29)9-5-6-12-28)26(36)33-13-7-11-22(33)25(35)31-21(27(37)38)14-17-15-30-20-10-4-3-8-18(17)20/h3-4,8,10,15-16,19,21-23,30H,5-7,9,11-14,28-29H2,1-2H3,(H,31,35)(H,32,34)(H,37,38) |
| InChIKey | LXCABPPXBJZINL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 183.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|