C25H36N6O5 — CID 18307866
2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18307866) has the molecular formula C25H36N6O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18307866 |
| Molecular Formula | C25H36N6O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N6O5/c1-15(29-23(33)21-10-6-12-31(21)24(34)18(27)8-4-5-11-26)22(32)30-20(25(35)36)13-16-14-28-19-9-3-2-7-17(16)19/h2-3,7,9,14-15,18,20-21,28H,4-6,8,10-13,26-27H2,1H3,(H,29,33)(H,30,32)(H,35,36) |
| InChIKey | VUBIYSQFGCNPKK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 183.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|