C18H19IN6O — CID 122591752
2-iodo-1-[6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]-3-pyridinyl]ethanone (PubChem CID 122591752) has the molecular formula C18H19IN6O and a molecular weight of 462.30 g/mol. Its IUPAC name is 2-iodo-1-[6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]-3-pyridinyl]ethanone.
| Compound Name | 2-iodo-1-[6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 122591752 |
| Molecular Formula | C18H19IN6O |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-iodo-1-[6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]-3-pyridinyl]ethanone |
| SMILES | CN(c1ccc(C(=O)CI)cn1)[C@@H]1CCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C18H19IN6O/c1-24(16-3-2-12(9-21-16)15(26)8-19)13-5-7-25(10-13)18-14-4-6-20-17(14)22-11-23-18/h2-4,6,9,11,13H,5,7-8,10H2,1H3,(H,20,22,23)/t13-/m1/s1 |
| InChIKey | FURUXVDQWVSPPI-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|