C18H18N6 — CID 140613497
(3R)-N-(3-isocyanophenyl)-N-methyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-amine (PubChem CID 140613497) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is (3R)-N-(3-isocyanophenyl)-N-methyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-amine.
| Compound Name | (3R)-N-(3-isocyanophenyl)-N-methyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 140613497 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3R)-N-(3-isocyanophenyl)-N-methyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-amine |
| SMILES | [C-]#[N+]c1cccc(N(C)[C@@H]2CCN(c3ncnc4[nH]ccc34)C2)c1 |
| InChI | InChI=1S/C18H18N6/c1-19-13-4-3-5-14(10-13)23(2)15-7-9-24(11-15)18-16-6-8-20-17(16)21-12-22-18/h3-6,8,10,12,15H,7,9,11H2,2H3,(H,20,21,22)/t15-/m1/s1 |
| InChIKey | PWDQOVKGPNIXJB-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 52.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|