C19H18FN7O — CID 140935003
3-(3-fluoro-4-isocyanophenyl)-1-methyl-1-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]urea (PubChem CID 140935003) has the molecular formula C19H18FN7O and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-(3-fluoro-4-isocyanophenyl)-1-methyl-1-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]urea.
| Compound Name | 3-(3-fluoro-4-isocyanophenyl)-1-methyl-1-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 140935003 |
| Molecular Formula | C19H18FN7O |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-(3-fluoro-4-isocyanophenyl)-1-methyl-1-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]urea |
| SMILES | [C-]#[N+]c1ccc(NC(=O)N(C)[C@@H]2CCN(c3ncnc4[nH]ccc34)C2)cc1F |
| InChI | InChI=1S/C19H18FN7O/c1-21-16-4-3-12(9-15(16)20)25-19(28)26(2)13-6-8-27(10-13)18-14-5-7-22-17(14)23-11-24-18/h3-5,7,9,11,13H,6,8,10H2,2H3,(H,25,28)(H,22,23,24)/t13-/m1/s1 |
| InChIKey | ZVTGEHJUZULEFL-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|