C16H16N8 — CID 140934992
5-isocyano-N-methyl-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 140934992) has the molecular formula C16H16N8 and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-isocyano-N-methyl-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | 5-isocyano-N-methyl-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 140934992 |
| Molecular Formula | C16H16N8 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-isocyano-N-methyl-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(N(C)[C@@H]2CCN(c3ncnc4[nH]ccc34)C2)cn1 |
| InChI | InChI=1S/C16H16N8/c1-17-13-7-20-14(8-19-13)23(2)11-4-6-24(9-11)16-12-3-5-18-15(12)21-10-22-16/h3,5,7-8,10-11H,4,6,9H2,2H3,(H,18,21,22)/t11-/m1/s1 |
| InChIKey | NYUFJTJBCOCZRG-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|