C18H17NO — CID 122591865
4-(5a,8,9,9a-tetrahydrodibenzofuran-1-yl)aniline (PubChem CID 122591865) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(5a,8,9,9a-tetrahydrodibenzofuran-1-yl)aniline.
| Compound Name | 4-(5a,8,9,9a-tetrahydrodibenzofuran-1-yl)aniline |
|---|---|
| PubChem CID | 122591865 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-(5a,8,9,9a-tetrahydrodibenzofuran-1-yl)aniline |
| SMILES | Nc1ccc(-c2cccc3c2C2CCC=CC2O3)cc1 |
| InChI | InChI=1S/C18H17NO/c19-13-10-8-12(9-11-13)14-5-3-7-17-18(14)15-4-1-2-6-16(15)20-17/h2-3,5-11,15-16H,1,4,19H2 |
| InChIKey | DAIIXSWKRLDCCX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|