C18H20O9 — CID 122591986
7-[(2S,3R,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-4,8-dihydroxy-3-methylnaphthalene-1,2-dione (PubChem CID 122591986) has the molecular formula C18H20O9 and a molecular weight of 380.35 g/mol. Its IUPAC name is 7-[(2S,3R,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-4,8-dihydroxy-3-methylnaphthalene-1,2-dione.
| Compound Name | 7-[(2S,3R,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-4,8-dihydroxy-3-methylnaphthalene-1,2-dione |
|---|---|
| PubChem CID | 122591986 |
| Molecular Formula | C18H20O9 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 7-[(2S,3R,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-4,8-dihydroxy-3-methylnaphthalene-1,2-dione |
| SMILES | CC1=C(O)c2ccc(O[C@@H]3OC(CO)[C@@H](C)C(O)[C@H]3O)c(O)c2C(=O)C1=O |
| InChI | InChI=1S/C18H20O9/c1-6-10(5-19)27-18(17(25)13(6)21)26-9-4-3-8-11(15(9)23)16(24)14(22)7(2)12(8)20/h3-4,6,10,13,17-21,23,25H,5H2,1-2H3/t6-,10?,13?,17-,18-/m1/s1 |
| InChIKey | HWUNUKQAMNVREN-PYOYZAEVSA-N |
| XLogP | -0.10 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|