C19H17FN6O2 — CID 122594287
2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]acetamide (PubChem CID 122594287) has the molecular formula C19H17FN6O2 and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]acetamide.
| Compound Name | 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 122594287 |
| Molecular Formula | C19H17FN6O2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]acetamide |
| SMILES | Cc1nnc(-c2ccc(CNC(=O)CO/N=C/c3ccc([18F])cc3)cc2)nn1 |
| InChI | InChI=1S/C19H17FN6O2/c1-13-23-25-19(26-24-13)16-6-2-14(3-7-16)10-21-18(27)12-28-22-11-15-4-8-17(20)9-5-15/h2-9,11H,10,12H2,1H3,(H,21,27)/b22-11+/i20-1 |
| InChIKey | WKWNDAGDNHUBJJ-MNJFPFFJSA-N |
| XLogP | 2.05 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|