C31H41FN4O2 — CID 172966799
2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methyl]acetamide;2-methylpropane (PubChem CID 172966799) has the molecular formula C31H41FN4O2 and a molecular weight of 519.70 g/mol. Its IUPAC name is 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methyl]acetamide;2-methylpropane.
| Compound Name | 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methyl]acetamide;2-methylpropane |
|---|---|
| PubChem CID | 172966799 |
| Molecular Formula | C31H41FN4O2 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | 2-[(E)-(4-fluorophenyl)methylideneamino]oxy-N-[[4-(1-methyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-4-yl)phenyl]methyl]acetamide;2-methylpropane |
| SMILES | CC(C)C.CC1=NN=C(c2ccc(CNC(=O)CO/N=C/c3ccc([18F])cc3)cc2)C2CCCCCCC12 |
| InChI | InChI=1S/C27H31FN4O2.C4H10/c1-19-24-6-4-2-3-5-7-25(24)27(32-31-19)22-12-8-20(9-13-22)16-29-26(33)18-34-30-17-21-10-14-23(28)15-11-21;1-4(2)3/h8-15,17,24-25H,2-7,16,18H2,1H3,(H,29,33);4H,1-3H3/b30-17+;/i28-1; |
| InChIKey | JYRSDDLZXSLUQV-XUXQYGSQSA-N |
| XLogP | 6.92 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|