C24H33N7O2 — CID 122596912
tert-butyl N-[1-[7-(3-aminoanilino)-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-3-yl]carbamate (PubChem CID 122596912) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is tert-butyl N-[1-[7-(3-aminoanilino)-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[7-(3-aminoanilino)-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 122596912 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | tert-butyl N-[1-[7-(3-aminoanilino)-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-3-yl]carbamate |
| SMILES | CCc1cnn2c(Nc3cccc(N)c3)cc(N3CCCC(NC(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C24H33N7O2/c1-5-16-14-26-31-21(27-18-9-6-8-17(25)12-18)13-20(29-22(16)31)30-11-7-10-19(15-30)28-23(32)33-24(2,3)4/h6,8-9,12-14,19,27H,5,7,10-11,15,25H2,1-4H3,(H,28,32) |
| InChIKey | WVMVCKRGVYWMJQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|