C14H28OS — CID 122599337
(5R)-2-ethyl-3,3,4,5-tetramethyl-6-propan-2-ylsulfanyloxane (PubChem CID 122599337) has the molecular formula C14H28OS and a molecular weight of 244.44 g/mol. Its IUPAC name is (5R)-2-ethyl-3,3,4,5-tetramethyl-6-propan-2-ylsulfanyloxane.
| Compound Name | (5R)-2-ethyl-3,3,4,5-tetramethyl-6-propan-2-ylsulfanyloxane |
|---|---|
| PubChem CID | 122599337 |
| Molecular Formula | C14H28OS |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (5R)-2-ethyl-3,3,4,5-tetramethyl-6-propan-2-ylsulfanyloxane |
| SMILES | CCC1OC(SC(C)C)[C@H](C)C(C)C1(C)C |
| InChI | InChI=1S/C14H28OS/c1-8-12-14(6,7)11(5)10(4)13(15-12)16-9(2)3/h9-13H,8H2,1-7H3/t10-,11?,12?,13?/m1/s1 |
| InChIKey | QDDNCRCLERPASI-PEWWYSNMSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |