C13H14N4O3 — CID 122601852
(2,5-diamino-6-ethoxypyrimidin-4-yl) benzoate (PubChem CID 122601852) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is (2,5-diamino-6-ethoxypyrimidin-4-yl) benzoate.
| Compound Name | (2,5-diamino-6-ethoxypyrimidin-4-yl) benzoate |
|---|---|
| PubChem CID | 122601852 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2,5-diamino-6-ethoxypyrimidin-4-yl) benzoate |
| SMILES | CCOc1nc(N)nc(OC(=O)c2ccccc2)c1N |
| InChI | InChI=1S/C13H14N4O3/c1-2-19-10-9(14)11(17-13(15)16-10)20-12(18)8-6-4-3-5-7-8/h3-7H,2,14H2,1H3,(H2,15,16,17) |
| InChIKey | DMIPPZSLXZVULY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |