C9H11F2N3 — CID 122605817
2-(3-azido-2,2-difluoropropyl)cyclohexa-1,3-diene (PubChem CID 122605817) has the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(3-azido-2,2-difluoropropyl)cyclohexa-1,3-diene.
| Compound Name | 2-(3-azido-2,2-difluoropropyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 122605817 |
| Molecular Formula | C9H11F2N3 |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-(3-azido-2,2-difluoropropyl)cyclohexa-1,3-diene |
| SMILES | [N-]=[N+]=NCC(F)(F)CC1=CCCC=C1 |
| InChI | InChI=1S/C9H11F2N3/c10-9(11,7-13-14-12)6-8-4-2-1-3-5-8/h2,4-5H,1,3,6-7H2 |
| InChIKey | NAKFUMLJMKFFNS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|