About 4-azidobutylbenzene;nobelium
4-azidobutylbenzene;nobelium (PubChem CID 59154714) has the molecular formula C10H12N3No2-
and a molecular weight of 692.23 g/mol. Its IUPAC name is 4-azidobutylbenzene;nobelium.
Molecular Properties
| Compound Name | 4-azidobutylbenzene;nobelium |
| PubChem CID | 59154714 |
| Molecular Formula | C10H12N3No2- |
| Molecular Weight | 692.23 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | 4-azidobutylbenzene;nobelium |
| SMILES | [N-]=[N+]=NCCCCc1cc[c-]cc1.[No].[No] |
| InChI | InChI=1S/C10H12N3.2No/c11-13-12-9-5-4-8-10-6-2-1-3-7-10;;/h2-3,6-7H,4-5,8-9H2;;/q-1;; |
| InChIKey | HGYSBGYFUUSUEG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 692.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-azidobutylbenzene;nobelium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidobutylbenzene;nobelium?
The IUPAC name of 4-azidobutylbenzene;nobelium (CID 59154714) is 4-azidobutylbenzene;nobelium.
What is the SMILES notation for 4-azidobutylbenzene;nobelium?
The canonical SMILES for 4-azidobutylbenzene;nobelium is [N-]=[N+]=NCCCCc1cc[c-]cc1.[No].[No].
What is the InChIKey of 4-azidobutylbenzene;nobelium?
The InChIKey is HGYSBGYFUUSUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N3.2No/c11-13-12-9-5-4-8-10-6-2-1-3-7-10;;/h2-3,6-7H,4-5,8-9H2;;/q-1;;.
What are the key properties of 4-azidobutylbenzene;nobelium?
4-azidobutylbenzene;nobelium has a molecular weight of 692.23 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidobutylbenzene;nobelium is sourced from PubChem (CID 59154714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).