C10H12N2 — CID 142872779
methyl-[(Z)-(2-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]diazene (PubChem CID 142872779) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is methyl-[(Z)-(2-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]diazene.
| Compound Name | methyl-[(Z)-(2-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]diazene |
|---|---|
| PubChem CID | 142872779 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | methyl-[(Z)-(2-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]diazene |
| SMILES | C=c1cccc(C)/c1=C/N=N/C |
| InChI | InChI=1S/C10H12N2/c1-8-5-4-6-9(2)10(8)7-12-11-3/h4-7H,1H2,2-3H3/b10-7+,12-11+ |
| InChIKey | BCEVBTUFVQUZQK-OFJXCKHESA-N |
| XLogP | 1.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|