C8H6N2 — CID 23640502
3,4-diazabicyclo[4.2.2]deca-1,3,5,7,9-pentaene (PubChem CID 23640502) has the molecular formula C8H6N2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 3,4-diazabicyclo[4.2.2]deca-1,3,5,7,9-pentaene.
| Compound Name | 3,4-diazabicyclo[4.2.2]deca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 23640502 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 3,4-diazabicyclo[4.2.2]deca-1,3,5,7,9-pentaene |
| SMILES | C1=c2ccc(cc2)=C/N=N\1 |
| InChI | InChI=1S/C8H6N2/c1-2-8-4-3-7(1)5-9-10-6-8/h1-6H/b7-5-,8-6+,9-5-,10-6-,10-9- |
| InChIKey | XMXPAVZXFZBIKL-ULLJYMPXSA-N |
| XLogP | 0.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |