C9H8N2 — CID 54545031
4H-2,3-benzodiazepine (PubChem CID 54545031) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is 4H-2,3-benzodiazepine.
| Compound Name | 4H-2,3-benzodiazepine |
|---|---|
| PubChem CID | 54545031 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 4H-2,3-benzodiazepine |
| SMILES | C1=c2ccccc2=CN=NC1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-9-7-11-10-6-5-8(9)3-1/h1-5,7H,6H2 |
| InChIKey | ZFXPWCVUAFZYGC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |