C14H20N2O4S2 — CID 122605910
4-(4-methoxyphenyl)sulfonyl-8-sulfanyl-1-oxa-4,8-diazaspiro[4.5]decane (PubChem CID 122605910) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-8-sulfanyl-1-oxa-4,8-diazaspiro[4.5]decane.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-8-sulfanyl-1-oxa-4,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 122605910 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-8-sulfanyl-1-oxa-4,8-diazaspiro[4.5]decane |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC23CCN(S)CC3)cc1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-19-12-2-4-13(5-3-12)22(17,18)16-10-11-20-14(16)6-8-15(21)9-7-14/h2-5,21H,6-11H2,1H3 |
| InChIKey | VKEAZPKSEKGTDD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|